C26H44O3Si — CID 174054769
tert-butyl-[7-[(4S,5R)-2,2-dimethyl-5-[(E)-oct-1-enyl]-1,3-dioxolan-4-yl]hepta-4,6-diyn-3-yloxy]-dimethylsilane (PubChem CID 174054769) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is tert-butyl-[7-[(4S,5R)-2,2-dimethyl-5-[(E)-oct-1-enyl]-1,3-dioxolan-4-yl]hepta-4,6-diyn-3-yloxy]-dimethylsilane.
| Compound Name | tert-butyl-[7-[(4S,5R)-2,2-dimethyl-5-[(E)-oct-1-enyl]-1,3-dioxolan-4-yl]hepta-4,6-diyn-3-yloxy]-dimethylsilane |
|---|---|
| PubChem CID | 174054769 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | tert-butyl-[7-[(4S,5R)-2,2-dimethyl-5-[(E)-oct-1-enyl]-1,3-dioxolan-4-yl]hepta-4,6-diyn-3-yloxy]-dimethylsilane |
| SMILES | CCCCCC/C=C/[C@H]1OC(C)(C)O[C@H]1C#CC#CC(CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O3Si/c1-10-12-13-14-15-16-20-23-24(28-26(6,7)27-23)21-18-17-19-22(11-2)29-30(8,9)25(3,4)5/h16,20,22-24H,10-15H2,1-9H3/b20-16+/t22?,23-,24+/m1/s1 |
| InChIKey | RLXKJIWXYAESQS-GPOLRJQZSA-N |
| XLogP | 6.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|