C18H26O3 — CID 90957771
4-(8-methoxynon-6-en-2,4-diynyl)-2,2-dimethyl-5-propyl-1,3-dioxolane (PubChem CID 90957771) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 4-(8-methoxynon-6-en-2,4-diynyl)-2,2-dimethyl-5-propyl-1,3-dioxolane.
| Compound Name | 4-(8-methoxynon-6-en-2,4-diynyl)-2,2-dimethyl-5-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 90957771 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 4-(8-methoxynon-6-en-2,4-diynyl)-2,2-dimethyl-5-propyl-1,3-dioxolane |
| SMILES | CCCC1OC(C)(C)OC1CC#CC#CC=CC(C)OC |
| InChI | InChI=1S/C18H26O3/c1-6-12-16-17(21-18(3,4)20-16)14-11-9-7-8-10-13-15(2)19-5/h10,13,15-17H,6,12,14H2,1-5H3 |
| InChIKey | YEAJVBJSKVKKOA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|