C13H18O2 — CID 152587523
2-hex-2-ynyl-1,6-dioxaspiro[4.4]non-3-ene (PubChem CID 152587523) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-hex-2-ynyl-1,6-dioxaspiro[4.4]non-3-ene.
| Compound Name | 2-hex-2-ynyl-1,6-dioxaspiro[4.4]non-3-ene |
|---|---|
| PubChem CID | 152587523 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-hex-2-ynyl-1,6-dioxaspiro[4.4]non-3-ene |
| SMILES | CCCC#CCC1C=CC2(CCCO2)O1 |
| InChI | InChI=1S/C13H18O2/c1-2-3-4-5-7-12-8-10-13(15-12)9-6-11-14-13/h8,10,12H,2-3,6-7,9,11H2,1H3 |
| InChIKey | YUTOZHRZPUZYSI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|