C13H16O2 — CID 91751298
(2E)-2-[(2E,4E)-hexa-2,4-dienylidene]-1,6-dioxaspiro[4.4]non-3-ene (PubChem CID 91751298) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2E)-2-[(2E,4E)-hexa-2,4-dienylidene]-1,6-dioxaspiro[4.4]non-3-ene.
| Compound Name | (2E)-2-[(2E,4E)-hexa-2,4-dienylidene]-1,6-dioxaspiro[4.4]non-3-ene |
|---|---|
| PubChem CID | 91751298 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2E)-2-[(2E,4E)-hexa-2,4-dienylidene]-1,6-dioxaspiro[4.4]non-3-ene |
| SMILES | C/C=C/C=C/C=C1\C=CC2(CCCO2)O1 |
| InChI | InChI=1S/C13H16O2/c1-2-3-4-5-7-12-8-10-13(15-12)9-6-11-14-13/h2-5,7-8,10H,6,9,11H2,1H3/b3-2+,5-4+,12-7+ |
| InChIKey | ZDRLUYUPSIVYOD-ZHMYCGPMSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|