C22H38O2 — CID 58429883
(4Z,5S)-2,2-dimethyl-4-propylidene-5-tetradec-7-ynyl-1,3-dioxolane (PubChem CID 58429883) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is (4Z,5S)-2,2-dimethyl-4-propylidene-5-tetradec-7-ynyl-1,3-dioxolane.
| Compound Name | (4Z,5S)-2,2-dimethyl-4-propylidene-5-tetradec-7-ynyl-1,3-dioxolane |
|---|---|
| PubChem CID | 58429883 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | (4Z,5S)-2,2-dimethyl-4-propylidene-5-tetradec-7-ynyl-1,3-dioxolane |
| SMILES | CC/C=C1\OC(C)(C)O[C@H]1CCCCCCC#CCCCCCC |
| InChI | InChI=1S/C22H38O2/c1-5-7-8-9-10-11-12-13-14-15-16-17-19-21-20(18-6-2)23-22(3,4)24-21/h18,21H,5-10,13-17,19H2,1-4H3/b20-18-/t21-/m0/s1 |
| InChIKey | CTYZSBVGABKMMQ-SNSWJRJYSA-N |
| XLogP | 6.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|