C22H32O5 — CID 74956738
5,6-dimethoxy-5,6-dimethyl-3-tetradec-8-en-6,10-diynyl-1,4-dioxan-2-one (PubChem CID 74956738) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 5,6-dimethoxy-5,6-dimethyl-3-tetradec-8-en-6,10-diynyl-1,4-dioxan-2-one.
| Compound Name | 5,6-dimethoxy-5,6-dimethyl-3-tetradec-8-en-6,10-diynyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 74956738 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 5,6-dimethoxy-5,6-dimethyl-3-tetradec-8-en-6,10-diynyl-1,4-dioxan-2-one |
| SMILES | CCCC#CC=CC#CCCCCCC1OC(C)(OC)C(C)(OC)OC1=O |
| InChI | InChI=1S/C22H32O5/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(23)27-22(3,25-5)21(2,24-4)26-19/h10-11,19H,6-7,14-18H2,1-5H3 |
| InChIKey | SFHMXSKDCHRLPR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|