C24H36O5 — CID 14860162
methyl (7E)-7-[(3aS,6R,6aS)-2,2-dimethyl-6-octyl-4-oxo-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-5-ylidene]hept-5-ynoate (PubChem CID 14860162) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is methyl (7E)-7-[(3aS,6R,6aS)-2,2-dimethyl-6-octyl-4-oxo-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-5-ylidene]hept-5-ynoate.
| Compound Name | methyl (7E)-7-[(3aS,6R,6aS)-2,2-dimethyl-6-octyl-4-oxo-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-5-ylidene]hept-5-ynoate |
|---|---|
| PubChem CID | 14860162 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | methyl (7E)-7-[(3aS,6R,6aS)-2,2-dimethyl-6-octyl-4-oxo-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-5-ylidene]hept-5-ynoate |
| SMILES | CCCCCCCC[C@@H]1/C(=C\C#CCCCC(=O)OC)C(=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C24H36O5/c1-5-6-7-8-9-13-16-19-18(15-12-10-11-14-17-20(25)27-4)21(26)23-22(19)28-24(2,3)29-23/h15,19,22-23H,5-9,11,13-14,16-17H2,1-4H3/b18-15+/t19-,22+,23-/m1/s1 |
| InChIKey | IYAZPAPDKFKMAG-AUOGDUKMSA-N |
| XLogP | 4.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|