C13H17LiO2 — CID 166442817
lithium 7-pent-4-ynyl-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 166442817) has the molecular formula C13H17LiO2 and a molecular weight of 212.22 g/mol. Its IUPAC name is lithium 7-pent-4-ynyl-1,4-dioxaspiro[4.5]dec-6-ene.
| Compound Name | lithium 7-pent-4-ynyl-1,4-dioxaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 166442817 |
| Molecular Formula | C13H17LiO2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | lithium 7-pent-4-ynyl-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | [C-]#CCCCC1=CC2(CCC1)OCCO2.[Li+] |
| InChI | InChI=1S/C13H17O2.Li/c1-2-3-4-6-12-7-5-8-13(11-12)14-9-10-15-13;/h11H,3-10H2;/q-1;+1 |
| InChIKey | CRXYSSAFKDRONI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|