About 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+)
7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+) (PubChem CID 166436839) has the molecular formula C10H15IO2Zn
and a molecular weight of 359.52 g/mol. Its IUPAC name is 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+).
Molecular Properties
| Compound Name | 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+) |
| PubChem CID | 166436839 |
| Molecular Formula | C10H15IO2Zn |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+) |
| SMILES | [CH2-]CC1=CC2(CCC1)OCCO2.[Zn+]I |
| InChI | InChI=1S/C10H15O2.HI.Zn/c1-2-9-4-3-5-10(8-9)11-6-7-12-10;;/h8H,1-7H2;1H;/q-1;;+2/p-1 |
| InChIKey | DQUBPUFXUORNAM-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+)?
The IUPAC name of 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+) (CID 166436839) is 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+).
What is the SMILES notation for 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+)?
The canonical SMILES for 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+) is [CH2-]CC1=CC2(CCC1)OCCO2.[Zn+]I.
What is the InChIKey of 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+)?
The InChIKey is DQUBPUFXUORNAM-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H15O2.HI.Zn/c1-2-9-4-3-5-10(8-9)11-6-7-12-10;;/h8H,1-7H2;1H;/q-1;;+2/p-1.
What are the key properties of 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+)?
7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+) has a molecular weight of 359.52 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1,4-dioxaspiro[4.5]dec-6-ene;iodozinc(1+) is sourced from PubChem (CID 166436839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).