About 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene
7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 11266807) has the molecular formula C11H17IO2
and a molecular weight of 308.16 g/mol. Its IUPAC name is 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene.
Molecular Properties
| Compound Name | 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene |
| PubChem CID | 11266807 |
| Molecular Formula | C11H17IO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | ICCCC1=CC2(CCC1)OCCO2 |
| InChI | InChI=1S/C11H17IO2/c12-6-2-4-10-3-1-5-11(9-10)13-7-8-14-11/h9H,1-8H2 |
| InChIKey | JSWUBJBOTUNJGJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene?
The IUPAC name of 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene (CID 11266807) is 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene.
What is the SMILES notation for 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene?
The canonical SMILES for 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene is ICCCC1=CC2(CCC1)OCCO2.
What is the InChIKey of 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene?
The InChIKey is JSWUBJBOTUNJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17IO2/c12-6-2-4-10-3-1-5-11(9-10)13-7-8-14-11/h9H,1-8H2.
What are the key properties of 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene?
7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene has a molecular weight of 308.16 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-iodopropyl)-1,4-dioxaspiro[4.5]dec-6-ene is sourced from PubChem (CID 11266807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).