About 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene
6-iodo-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 14631807) has the molecular formula C8H11IO2
and a molecular weight of 266.08 g/mol. Its IUPAC name is 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene.
Molecular Properties
| Compound Name | 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene |
| PubChem CID | 14631807 |
| Molecular Formula | C8H11IO2 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | IC1=CCCCC12OCCO2 |
| InChI | InChI=1S/C8H11IO2/c9-7-3-1-2-4-8(7)10-5-6-11-8/h3H,1-2,4-6H2 |
| InChIKey | IOKMJHKGLZXNOG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene?
The IUPAC name of 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene (CID 14631807) is 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene.
What is the SMILES notation for 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene?
The canonical SMILES for 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene is IC1=CCCCC12OCCO2.
What is the InChIKey of 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene?
The InChIKey is IOKMJHKGLZXNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11IO2/c9-7-3-1-2-4-8(7)10-5-6-11-8/h3H,1-2,4-6H2.
What are the key properties of 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene?
6-iodo-1,4-dioxaspiro[4.5]dec-6-ene has a molecular weight of 266.08 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-1,4-dioxaspiro[4.5]dec-6-ene is sourced from PubChem (CID 14631807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).