C10H14O2 — CID 10558999
2-(cyclohexen-1-yl)-4-methylidene-1,3-dioxolane (PubChem CID 10558999) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-4-methylidene-1,3-dioxolane.
| Compound Name | 2-(cyclohexen-1-yl)-4-methylidene-1,3-dioxolane |
|---|---|
| PubChem CID | 10558999 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-(cyclohexen-1-yl)-4-methylidene-1,3-dioxolane |
| SMILES | C=C1COC(C2=CCCCC2)O1 |
| InChI | InChI=1S/C10H14O2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h5,10H,1-4,6-7H2 |
| InChIKey | PHVMCWBWUWETSZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|