C33H60O3Si2 — CID 11613803
triethyl-[(3S,4S,5E)-7-prop-2-enoxy-4-[(3R)-8-tri(propan-2-yl)silyloct-1-en-7-yn-3-yl]oxyhepta-1,5-dien-3-yl]oxysilane (PubChem CID 11613803) has the molecular formula C33H60O3Si2 and a molecular weight of 561.01 g/mol. Its IUPAC name is triethyl-[(3S,4S,5E)-7-prop-2-enoxy-4-[(3R)-8-tri(propan-2-yl)silyloct-1-en-7-yn-3-yl]oxyhepta-1,5-dien-3-yl]oxysilane.
| Compound Name | triethyl-[(3S,4S,5E)-7-prop-2-enoxy-4-[(3R)-8-tri(propan-2-yl)silyloct-1-en-7-yn-3-yl]oxyhepta-1,5-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 11613803 |
| Molecular Formula | C33H60O3Si2 |
| Molecular Weight | 561.01 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | triethyl-[(3S,4S,5E)-7-prop-2-enoxy-4-[(3R)-8-tri(propan-2-yl)silyloct-1-en-7-yn-3-yl]oxyhepta-1,5-dien-3-yl]oxysilane |
| SMILES | C=CCOC/C=C/[C@H](O[C@@H](C=C)CCCC#C[Si](C(C)C)(C(C)C)C(C)C)[C@H](C=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H60O3Si2/c1-13-25-34-26-22-24-33(32(15-3)36-37(16-4,17-5)18-6)35-31(14-2)23-20-19-21-27-38(28(7)8,29(9)10)30(11)12/h13-15,22,24,28-33H,1-3,16-20,23,25-26H2,4-12H3/b24-22+/t31-,32-,33-/m0/s1 |
| InChIKey | ROHWMHICJCKUFX-AIEUUNKWSA-N |
| XLogP | 9.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.01 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|