C18H34O2Si — CID 10828795
[(Z,2S)-2-(cyclopenten-1-yloxy)hept-3-enoxy]-triethylsilane (PubChem CID 10828795) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is [(Z,2S)-2-(cyclopenten-1-yloxy)hept-3-enoxy]-triethylsilane.
| Compound Name | [(Z,2S)-2-(cyclopenten-1-yloxy)hept-3-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 10828795 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [(Z,2S)-2-(cyclopenten-1-yloxy)hept-3-enoxy]-triethylsilane |
| SMILES | CCC/C=C\[C@@H](CO[Si](CC)(CC)CC)OC1=CCCC1 |
| InChI | InChI=1S/C18H34O2Si/c1-5-9-10-15-18(20-17-13-11-12-14-17)16-19-21(6-2,7-3)8-4/h10,13,15,18H,5-9,11-12,14,16H2,1-4H3/b15-10-/t18-/m0/s1 |
| InChIKey | PDHAMTTYQYJHSZ-BXBOZWQASA-N |
| XLogP | 5.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|