C34H70O2Si3 — CID 177269518
tri(propan-2-yl)-[(E)-7-trimethylsilyl-1-[1-tri(propan-2-yl)silyloxyhexyl]hept-2-en-6-ynoxy]silane (PubChem CID 177269518) has the molecular formula C34H70O2Si3 and a molecular weight of 595.19 g/mol. Its IUPAC name is tri(propan-2-yl)-[(E)-7-trimethylsilyl-1-[1-tri(propan-2-yl)silyloxyhexyl]hept-2-en-6-ynoxy]silane.
| Compound Name | tri(propan-2-yl)-[(E)-7-trimethylsilyl-1-[1-tri(propan-2-yl)silyloxyhexyl]hept-2-en-6-ynoxy]silane |
|---|---|
| PubChem CID | 177269518 |
| Molecular Formula | C34H70O2Si3 |
| Molecular Weight | 595.19 g/mol |
| Exact Mass | 594.47 |
| IUPAC Name | tri(propan-2-yl)-[(E)-7-trimethylsilyl-1-[1-tri(propan-2-yl)silyloxyhexyl]hept-2-en-6-ynoxy]silane |
| SMILES | CCCCCC(O[Si](C(C)C)(C(C)C)C(C)C)C(/C=C/CCC#C[Si](C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H70O2Si3/c1-17-18-21-24-33(35-38(27(2)3,28(4)5)29(6)7)34(25-22-19-20-23-26-37(14,15)16)36-39(30(8)9,31(10)11)32(12)13/h22,25,27-34H,17-21,24H2,1-16H3/b25-22+ |
| InChIKey | HCEOKVQGYQGJEC-YYDJUVGSSA-N |
| XLogP | 11.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.19 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|