C20H28O2Si — CID 10958433
tert-butyl-dimethyl-[(2S,3R)-2-[(E)-non-1-en-3,5,7-triynyl]oxan-3-yl]oxysilane (PubChem CID 10958433) has the molecular formula C20H28O2Si and a molecular weight of 328.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,3R)-2-[(E)-non-1-en-3,5,7-triynyl]oxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S,3R)-2-[(E)-non-1-en-3,5,7-triynyl]oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 10958433 |
| Molecular Formula | C20H28O2Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,3R)-2-[(E)-non-1-en-3,5,7-triynyl]oxan-3-yl]oxysilane |
| SMILES | CC#CC#CC#C/C=C/[C@@H]1OCCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H28O2Si/c1-7-8-9-10-11-12-13-15-18-19(16-14-17-21-18)22-23(5,6)20(2,3)4/h13,15,18-19H,14,16-17H2,1-6H3/b15-13+/t18-,19+/m0/s1 |
| InChIKey | OJDAKKAUHUGZDV-ZTIKBKQBSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|