C23H46O4Si2 — CID 11247734
tert-butyl-[(1E,4E)-5-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]penta-1,4-dienoxy]-dimethylsilane (PubChem CID 11247734) has the molecular formula C23H46O4Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is tert-butyl-[(1E,4E)-5-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]penta-1,4-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1E,4E)-5-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]penta-1,4-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11247734 |
| Molecular Formula | C23H46O4Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | tert-butyl-[(1E,4E)-5-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]penta-1,4-dienoxy]-dimethylsilane |
| SMILES | CC1(C)O[C@H](/C=C/C/C=C/O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H46O4Si2/c1-21(2,3)28(9,10)24-17-15-13-14-16-19-20(27-23(7,8)26-19)18-25-29(11,12)22(4,5)6/h14-17,19-20H,13,18H2,1-12H3/b16-14+,17-15+/t19-,20-/m1/s1 |
| InChIKey | WRWOFYZYEXNMHI-RWVSBWLQSA-N |
| XLogP | 7.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|