C9H13IN2 — CID 134877000
1,2,4a,8a-tetrahydroquinolin-1-ium-1-amine iodide (PubChem CID 134877000) has the molecular formula C9H13IN2 and a molecular weight of 276.12 g/mol. Its IUPAC name is 1,2,4a,8a-tetrahydroquinolin-1-ium-1-amine iodide.
| Compound Name | 1,2,4a,8a-tetrahydroquinolin-1-ium-1-amine iodide |
|---|---|
| PubChem CID | 134877000 |
| Molecular Formula | C9H13IN2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1,2,4a,8a-tetrahydroquinolin-1-ium-1-amine iodide |
| SMILES | N[NH+]1CC=CC2C=CC=CC21.[I-] |
| InChI | InChI=1S/C9H12N2.HI/c10-11-7-3-5-8-4-1-2-6-9(8)11;/h1-6,8-9H,7,10H2;1H |
| InChIKey | FRMSQTQFDUYXRE-UHFFFAOYSA-N |
| XLogP | -3.57 |
| TPSA | 30.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|