C11H16N2 — CID 163705288
N,2-dimethyl-4a,8a-dihydro-2H-quinolin-1-amine (PubChem CID 163705288) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N,2-dimethyl-4a,8a-dihydro-2H-quinolin-1-amine.
| Compound Name | N,2-dimethyl-4a,8a-dihydro-2H-quinolin-1-amine |
|---|---|
| PubChem CID | 163705288 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N,2-dimethyl-4a,8a-dihydro-2H-quinolin-1-amine |
| SMILES | CNN1C(C)C=CC2C=CC=CC21 |
| InChI | InChI=1S/C11H16N2/c1-9-7-8-10-5-3-4-6-11(10)13(9)12-2/h3-12H,1-2H3 |
| InChIKey | KENRECBURPOOCY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|