C12H20N2 — CID 144825298
(3R)-1-(cyclohexa-2,4-dien-1-ylmethyl)-3-methyldiazinane (PubChem CID 144825298) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (3R)-1-(cyclohexa-2,4-dien-1-ylmethyl)-3-methyldiazinane.
| Compound Name | (3R)-1-(cyclohexa-2,4-dien-1-ylmethyl)-3-methyldiazinane |
|---|---|
| PubChem CID | 144825298 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (3R)-1-(cyclohexa-2,4-dien-1-ylmethyl)-3-methyldiazinane |
| SMILES | C[C@@H]1CCCN(CC2C=CC=CC2)N1 |
| InChI | InChI=1S/C12H20N2/c1-11-6-5-9-14(13-11)10-12-7-3-2-4-8-12/h2-4,7,11-13H,5-6,8-10H2,1H3/t11-,12?/m1/s1 |
| InChIKey | AOZWSXHAEJBDBN-JHJMLUEUSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |