C12H20N2 — CID 123942003
4-(1-methylpiperidin-4-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 123942003) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-(1-methylpiperidin-4-yl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 4-(1-methylpiperidin-4-yl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123942003 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-(1-methylpiperidin-4-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | CN1CCC(C2=CCC(N)C=C2)CC1 |
| InChI | InChI=1S/C12H20N2/c1-14-8-6-11(7-9-14)10-2-4-12(13)5-3-10/h2-4,11-12H,5-9,13H2,1H3 |
| InChIKey | GPNUELOYUSLBDR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |