About 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene
9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene (PubChem CID 90909223) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene.
Molecular Properties
| Compound Name | 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene |
| PubChem CID | 90909223 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene |
| SMILES | CC1C2C=CCN1NCC2 |
| InChI | InChI=1S/C8H14N2/c1-7-8-3-2-6-10(7)9-5-4-8/h2-3,7-9H,4-6H2,1H3 |
| InChIKey | VJSGSKFJWLRKHW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene?
The IUPAC name of 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene (CID 90909223) is 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene.
What is the SMILES notation for 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene?
The canonical SMILES for 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene is CC1C2C=CCN1NCC2.
What is the InChIKey of 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene?
The InChIKey is VJSGSKFJWLRKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-7-8-3-2-6-10(7)9-5-4-8/h2-3,7-9H,4-6H2,1H3.
What are the key properties of 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene?
9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene has a molecular weight of 138.21 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-1,2-diazabicyclo[3.3.1]non-6-ene is sourced from PubChem (CID 90909223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).