C10H17N3 — CID 163758192
(2R)-9-methyl-4,9,10-triazatricyclo[6.4.0.02,4]dodec-6-ene (PubChem CID 163758192) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (2R)-9-methyl-4,9,10-triazatricyclo[6.4.0.02,4]dodec-6-ene.
| Compound Name | (2R)-9-methyl-4,9,10-triazatricyclo[6.4.0.02,4]dodec-6-ene |
|---|---|
| PubChem CID | 163758192 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (2R)-9-methyl-4,9,10-triazatricyclo[6.4.0.02,4]dodec-6-ene |
| SMILES | CN1NCCC2C1C=CCN1C[C@@H]21 |
| InChI | InChI=1S/C10H17N3/c1-12-9-3-2-6-13-7-10(13)8(9)4-5-11-12/h2-3,8-11H,4-7H2,1H3/t8?,9?,10-,13?/m0/s1 |
| InChIKey | LVWXPNNGMDKLGU-ITGBVKDJSA-N |
| XLogP | 0.07 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|