C9H14N2 — CID 154385450
3-methyl-2,4,8,8a-tetrahydro-1H-phthalazine (PubChem CID 154385450) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-methyl-2,4,8,8a-tetrahydro-1H-phthalazine.
| Compound Name | 3-methyl-2,4,8,8a-tetrahydro-1H-phthalazine |
|---|---|
| PubChem CID | 154385450 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-methyl-2,4,8,8a-tetrahydro-1H-phthalazine |
| SMILES | CN1CC2=CC=CCC2CN1 |
| InChI | InChI=1S/C9H14N2/c1-11-7-9-5-3-2-4-8(9)6-10-11/h2-3,5,8,10H,4,6-7H2,1H3 |
| InChIKey | GHFQXNMZTISBPB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |