C14H23FN2 — CID 143466131
4-[(4Z,6E)-7-fluoroocta-2,4,6-trien-3-yl]-N-methylpiperidin-1-amine (PubChem CID 143466131) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is 4-[(4Z,6E)-7-fluoroocta-2,4,6-trien-3-yl]-N-methylpiperidin-1-amine.
| Compound Name | 4-[(4Z,6E)-7-fluoroocta-2,4,6-trien-3-yl]-N-methylpiperidin-1-amine |
|---|---|
| PubChem CID | 143466131 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4-[(4Z,6E)-7-fluoroocta-2,4,6-trien-3-yl]-N-methylpiperidin-1-amine |
| SMILES | CC=C(/C=C\C=C(/C)F)C1CCN(NC)CC1 |
| InChI | InChI=1S/C14H23FN2/c1-4-13(7-5-6-12(2)15)14-8-10-17(16-3)11-9-14/h4-7,14,16H,8-11H2,1-3H3/b7-5-,12-6+,13-4? |
| InChIKey | SASDGTVZMGBSIG-RNCZRJFXSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|