C13H26N2 — CID 123196619
2-(3,4-dimethylhepta-4,6-dienyl)-1,1-diethylhydrazine (PubChem CID 123196619) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 2-(3,4-dimethylhepta-4,6-dienyl)-1,1-diethylhydrazine.
| Compound Name | 2-(3,4-dimethylhepta-4,6-dienyl)-1,1-diethylhydrazine |
|---|---|
| PubChem CID | 123196619 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2-(3,4-dimethylhepta-4,6-dienyl)-1,1-diethylhydrazine |
| SMILES | C=CC=C(C)C(C)CCNN(CC)CC |
| InChI | InChI=1S/C13H26N2/c1-6-9-12(4)13(5)10-11-14-15(7-2)8-3/h6,9,13-14H,1,7-8,10-11H2,2-5H3 |
| InChIKey | DSBWEOOKASJHFU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|