C9H16N2 — CID 141291454
2-(2-cyclopenta-2,4-dien-1-ylethyl)-1,1-dimethylhydrazine (PubChem CID 141291454) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-(2-cyclopenta-2,4-dien-1-ylethyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(2-cyclopenta-2,4-dien-1-ylethyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 141291454 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-(2-cyclopenta-2,4-dien-1-ylethyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NCCC1C=CC=C1 |
| InChI | InChI=1S/C9H16N2/c1-11(2)10-8-7-9-5-3-4-6-9/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | RPXHTWSOCFEPFL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|