C10H18N2 — CID 123550909
(3-ethylidene-6-methylhepta-4,6-dienyl)hydrazine (PubChem CID 123550909) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (3-ethylidene-6-methylhepta-4,6-dienyl)hydrazine.
| Compound Name | (3-ethylidene-6-methylhepta-4,6-dienyl)hydrazine |
|---|---|
| PubChem CID | 123550909 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3-ethylidene-6-methylhepta-4,6-dienyl)hydrazine |
| SMILES | C=C(C)C=CC(=CC)CCNN |
| InChI | InChI=1S/C10H18N2/c1-4-10(7-8-12-11)6-5-9(2)3/h4-6,12H,2,7-8,11H2,1,3H3 |
| InChIKey | IGHIQRIUKWDXMY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|