C10H17FN2 — CID 163665190
[(4E)-4-[(E)-2-fluoroprop-1-enyl]hepta-4,6-dien-3-yl]hydrazine (PubChem CID 163665190) has the molecular formula C10H17FN2 and a molecular weight of 184.26 g/mol. Its IUPAC name is [(4E)-4-[(E)-2-fluoroprop-1-enyl]hepta-4,6-dien-3-yl]hydrazine.
| Compound Name | [(4E)-4-[(E)-2-fluoroprop-1-enyl]hepta-4,6-dien-3-yl]hydrazine |
|---|---|
| PubChem CID | 163665190 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | [(4E)-4-[(E)-2-fluoroprop-1-enyl]hepta-4,6-dien-3-yl]hydrazine |
| SMILES | C=C/C=C(\C=C(/C)F)C(CC)NN |
| InChI | InChI=1S/C10H17FN2/c1-4-6-9(7-8(3)11)10(5-2)13-12/h4,6-7,10,13H,1,5,12H2,2-3H3/b8-7+,9-6+ |
| InChIKey | IXURCQDTPKJKOF-KHHFIZIMSA-N |
| XLogP | 2.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|