C8H11FN2 — CID 123304342
(2-fluoro-3-methylidenecyclohexa-1,5-dien-1-yl)methylhydrazine (PubChem CID 123304342) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is (2-fluoro-3-methylidenecyclohexa-1,5-dien-1-yl)methylhydrazine.
| Compound Name | (2-fluoro-3-methylidenecyclohexa-1,5-dien-1-yl)methylhydrazine |
|---|---|
| PubChem CID | 123304342 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (2-fluoro-3-methylidenecyclohexa-1,5-dien-1-yl)methylhydrazine |
| SMILES | C=C1CC=CC(CNN)=C1F |
| InChI | InChI=1S/C8H11FN2/c1-6-3-2-4-7(5-11-10)8(6)9/h2,4,11H,1,3,5,10H2 |
| InChIKey | LPUCICCEQMEVKP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|