C7H11FN2 — CID 123941986
(2-fluorocyclohexa-1,3-dien-1-yl)methylhydrazine (PubChem CID 123941986) has the molecular formula C7H11FN2 and a molecular weight of 142.18 g/mol. Its IUPAC name is (2-fluorocyclohexa-1,3-dien-1-yl)methylhydrazine.
| Compound Name | (2-fluorocyclohexa-1,3-dien-1-yl)methylhydrazine |
|---|---|
| PubChem CID | 123941986 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | (2-fluorocyclohexa-1,3-dien-1-yl)methylhydrazine |
| SMILES | NNCC1=C(F)C=CCC1 |
| InChI | InChI=1S/C7H11FN2/c8-7-4-2-1-3-6(7)5-10-9/h2,4,10H,1,3,5,9H2 |
| InChIKey | VUHIQMWCQNQQMH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|