C8H9FN2 — CID 133062589
6-fluoro-1,2,3,8a-tetrahydrocinnoline (PubChem CID 133062589) has the molecular formula C8H9FN2 and a molecular weight of 152.17 g/mol. Its IUPAC name is 6-fluoro-1,2,3,8a-tetrahydrocinnoline.
| Compound Name | 6-fluoro-1,2,3,8a-tetrahydrocinnoline |
|---|---|
| PubChem CID | 133062589 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 6-fluoro-1,2,3,8a-tetrahydrocinnoline |
| SMILES | FC1=CC2=CCNNC2C=C1 |
| InChI | InChI=1S/C8H9FN2/c9-7-1-2-8-6(5-7)3-4-10-11-8/h1-3,5,8,10-11H,4H2 |
| InChIKey | TXYAVWZXMCYNEU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |