C10H22N4 — CID 57147725
(1-hydrazinyl-3-propylidenehept-4-enyl)hydrazine (PubChem CID 57147725) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1-hydrazinyl-3-propylidenehept-4-enyl)hydrazine.
| Compound Name | (1-hydrazinyl-3-propylidenehept-4-enyl)hydrazine |
|---|---|
| PubChem CID | 57147725 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | (1-hydrazinyl-3-propylidenehept-4-enyl)hydrazine |
| SMILES | CCC=CC(=CCC)CC(NN)NN |
| InChI | InChI=1S/C10H22N4/c1-3-5-7-9(6-4-2)8-10(13-11)14-12/h5-7,10,13-14H,3-4,8,11-12H2,1-2H3 |
| InChIKey | OSNOADCKPLGHDW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|