C13H24N2 — CID 107907725
N-cyclohex-2-en-1-yl-2,6-dimethylpiperidin-1-amine (PubChem CID 107907725) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-2,6-dimethylpiperidin-1-amine.
| Compound Name | N-cyclohex-2-en-1-yl-2,6-dimethylpiperidin-1-amine |
|---|---|
| PubChem CID | 107907725 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-cyclohex-2-en-1-yl-2,6-dimethylpiperidin-1-amine |
| SMILES | CC1CCCC(C)N1NC1C=CCCC1 |
| InChI | InChI=1S/C13H24N2/c1-11-7-6-8-12(2)15(11)14-13-9-4-3-5-10-13/h4,9,11-14H,3,5-8,10H2,1-2H3 |
| InChIKey | ZNEUEBXVPKGLQA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|