C7H12N2 — CID 167530645
2-methyl-2,3-diazabicyclo[2.2.2]oct-5-ene (PubChem CID 167530645) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 2-methyl-2,3-diazabicyclo[2.2.2]oct-5-ene.
| Compound Name | 2-methyl-2,3-diazabicyclo[2.2.2]oct-5-ene |
|---|---|
| PubChem CID | 167530645 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2-methyl-2,3-diazabicyclo[2.2.2]oct-5-ene |
| SMILES | CN1NC2C=CC1CC2 |
| InChI | InChI=1S/C7H12N2/c1-9-7-4-2-6(8-9)3-5-7/h2,4,6-8H,3,5H2,1H3 |
| InChIKey | FTRCHZOEWBYNLU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|