C9H16N2 — CID 139835795
1,2,3,4,4a,5,8,9-octahydropyridazino[1,6-a]azepine (PubChem CID 139835795) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,2,3,4,4a,5,8,9-octahydropyridazino[1,6-a]azepine.
| Compound Name | 1,2,3,4,4a,5,8,9-octahydropyridazino[1,6-a]azepine |
|---|---|
| PubChem CID | 139835795 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,2,3,4,4a,5,8,9-octahydropyridazino[1,6-a]azepine |
| SMILES | C1=CCC2CCCNN2CC1 |
| InChI | InChI=1S/C9H16N2/c1-2-5-9-6-4-7-10-11(9)8-3-1/h1-2,9-10H,3-8H2 |
| InChIKey | FOHFEUXESASVPE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|