C10H20N4 — CID 143295002
4-N-(3,6-dihydro-2H-pyridin-1-yl)piperidine-1,4-diamine (PubChem CID 143295002) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 4-N-(3,6-dihydro-2H-pyridin-1-yl)piperidine-1,4-diamine.
| Compound Name | 4-N-(3,6-dihydro-2H-pyridin-1-yl)piperidine-1,4-diamine |
|---|---|
| PubChem CID | 143295002 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 4-N-(3,6-dihydro-2H-pyridin-1-yl)piperidine-1,4-diamine |
| SMILES | NN1CCC(NN2CC=CCC2)CC1 |
| InChI | InChI=1S/C10H20N4/c11-13-8-4-10(5-9-13)12-14-6-2-1-3-7-14/h1-2,10,12H,3-9,11H2 |
| InChIKey | TTZYUGSJVVFSLJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|