C20H36N2 — CID 66986823
1-cycloundec-5-en-1-yl-1,2-diazacycloundec-7-ene (PubChem CID 66986823) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-7-ene.
| Compound Name | 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-7-ene |
|---|---|
| PubChem CID | 66986823 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-7-ene |
| SMILES | C1=CCCCC(N2CCCC=CCCCCN2)CCCCC1 |
| InChI | InChI=1S/C20H36N2/c1-2-5-9-13-17-20(16-12-8-4-1)22-19-15-11-7-3-6-10-14-18-21-22/h1,3-4,7,20-21H,2,5-6,8-19H2 |
| InChIKey | MFCIVZYYKAROLG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|