C8H16N2 — CID 107907714
2-cyclohex-2-en-1-yl-1,1-dimethylhydrazine (PubChem CID 107907714) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-yl-1,1-dimethylhydrazine.
| Compound Name | 2-cyclohex-2-en-1-yl-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 107907714 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2-cyclohex-2-en-1-yl-1,1-dimethylhydrazine |
| SMILES | CN(C)NC1C=CCCC1 |
| InChI | InChI=1S/C8H16N2/c1-10(2)9-8-6-4-3-5-7-8/h4,6,8-9H,3,5,7H2,1-2H3 |
| InChIKey | HWZBKOZMBLTHDS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|