C6H12N2 — CID 167530640
2,3-dimethyl-3,6-dihydro-1H-pyridazine (PubChem CID 167530640) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 2,3-dimethyl-3,6-dihydro-1H-pyridazine.
| Compound Name | 2,3-dimethyl-3,6-dihydro-1H-pyridazine |
|---|---|
| PubChem CID | 167530640 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 2,3-dimethyl-3,6-dihydro-1H-pyridazine |
| SMILES | CC1C=CCNN1C |
| InChI | InChI=1S/C6H12N2/c1-6-4-3-5-7-8(6)2/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | SZHZRNODABHPOE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|