C6H12N2 — CID 134887355
(3S,6R)-3,6-dimethyl-1,2,3,6-tetrahydropyridazine (PubChem CID 134887355) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (3S,6R)-3,6-dimethyl-1,2,3,6-tetrahydropyridazine.
| Compound Name | (3S,6R)-3,6-dimethyl-1,2,3,6-tetrahydropyridazine |
|---|---|
| PubChem CID | 134887355 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (3S,6R)-3,6-dimethyl-1,2,3,6-tetrahydropyridazine |
| SMILES | C[C@@H]1C=C[C@H](C)NN1 |
| InChI | InChI=1S/C6H12N2/c1-5-3-4-6(2)8-7-5/h3-8H,1-2H3/t5-,6+ |
| InChIKey | IKJZVITXXYCFKB-OLQVQODUSA-N |
| XLogP | 0.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|