About 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine
5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine (PubChem CID 176804552) has the molecular formula C6H11FN2
and a molecular weight of 130.17 g/mol. Its IUPAC name is 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine.
Analyze 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine?
The IUPAC name of 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine (CID 176804552) is 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine.
What is the SMILES notation for 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine?
The canonical SMILES for 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine is CC1NN(C)CC=C1F.
What is the InChIKey of 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine?
The InChIKey is RQRJHLGZBCPWSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN2/c1-5-6(7)3-4-9(2)8-5/h3,5,8H,4H2,1-2H3.
What are the key properties of 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine?
5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine has a molecular weight of 130.17 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine is sourced from PubChem (CID 176804552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).