C6H11FN2 — CID 176804567
4-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine (PubChem CID 176804567) has the molecular formula C6H11FN2 and a molecular weight of 130.17 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine.
| Compound Name | 4-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine |
|---|---|
| PubChem CID | 176804567 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-3,6-dihydro-1H-pyridazine |
| SMILES | CC1C=C(F)CN(C)N1 |
| InChI | InChI=1S/C6H11FN2/c1-5-3-6(7)4-9(2)8-5/h3,5,8H,4H2,1-2H3 |
| InChIKey | RTIMXUIPXHCUKY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |