C8H18N2 — CID 104655845
2-hex-5-en-2-yl-1,1-dimethylhydrazine (PubChem CID 104655845) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 2-hex-5-en-2-yl-1,1-dimethylhydrazine.
| Compound Name | 2-hex-5-en-2-yl-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 104655845 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2-hex-5-en-2-yl-1,1-dimethylhydrazine |
| SMILES | C=CCCC(C)NN(C)C |
| InChI | InChI=1S/C8H18N2/c1-5-6-7-8(2)9-10(3)4/h5,8-9H,1,6-7H2,2-4H3 |
| InChIKey | YYPJURHKHVJCGC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|