About ethane;pent-4-en-2-ylhydrazine
ethane;pent-4-en-2-ylhydrazine (PubChem CID 145462648) has the molecular formula C7H18N2
and a molecular weight of 130.23 g/mol. Its IUPAC name is ethane;pent-4-en-2-ylhydrazine.
Molecular Properties
| Compound Name | ethane;pent-4-en-2-ylhydrazine |
| PubChem CID | 145462648 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | ethane;pent-4-en-2-ylhydrazine |
| SMILES | C=CCC(C)NN.CC |
| InChI | InChI=1S/C5H12N2.C2H6/c1-3-4-5(2)7-6;1-2/h3,5,7H,1,4,6H2,2H3;1-2H3 |
| InChIKey | BLBNAENBOVBQDH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;pent-4-en-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pent-4-en-2-ylhydrazine?
The IUPAC name of ethane;pent-4-en-2-ylhydrazine (CID 145462648) is ethane;pent-4-en-2-ylhydrazine.
What is the SMILES notation for ethane;pent-4-en-2-ylhydrazine?
The canonical SMILES for ethane;pent-4-en-2-ylhydrazine is C=CCC(C)NN.CC.
What is the InChIKey of ethane;pent-4-en-2-ylhydrazine?
The InChIKey is BLBNAENBOVBQDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.C2H6/c1-3-4-5(2)7-6;1-2/h3,5,7H,1,4,6H2,2H3;1-2H3.
What are the key properties of ethane;pent-4-en-2-ylhydrazine?
ethane;pent-4-en-2-ylhydrazine has a molecular weight of 130.23 g/mol, XLogP of 1.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pent-4-en-2-ylhydrazine is sourced from PubChem (CID 145462648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).