C26H17F12N — CID 134877046
1,1-bis[3,5-bis(trifluoromethyl)phenyl]-N-(3-phenylpropyl)methanimine (PubChem CID 134877046) has the molecular formula C26H17F12N and a molecular weight of 571.41 g/mol. Its IUPAC name is 1,1-bis[3,5-bis(trifluoromethyl)phenyl]-N-(3-phenylpropyl)methanimine.
| Compound Name | 1,1-bis[3,5-bis(trifluoromethyl)phenyl]-N-(3-phenylpropyl)methanimine |
|---|---|
| PubChem CID | 134877046 |
| Molecular Formula | C26H17F12N |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 1,1-bis[3,5-bis(trifluoromethyl)phenyl]-N-(3-phenylpropyl)methanimine |
| SMILES | FC(F)(F)c1cc(C(=NCCCc2ccccc2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H17F12N/c27-23(28,29)18-9-16(10-19(13-18)24(30,31)32)22(39-8-4-7-15-5-2-1-3-6-15)17-11-20(25(33,34)35)14-21(12-17)26(36,37)38/h1-3,5-6,9-14H,4,7-8H2 |
| InChIKey | NZOAFNCISJFMTA-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|