C17H14F3N — CID 59051782
(3R)-3,5-diphenyl-3-(trifluoromethyl)-2,4-dihydropyrrole (PubChem CID 59051782) has the molecular formula C17H14F3N and a molecular weight of 289.30 g/mol. Its IUPAC name is (3R)-3,5-diphenyl-3-(trifluoromethyl)-2,4-dihydropyrrole.
| Compound Name | (3R)-3,5-diphenyl-3-(trifluoromethyl)-2,4-dihydropyrrole |
|---|---|
| PubChem CID | 59051782 |
| Molecular Formula | C17H14F3N |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (3R)-3,5-diphenyl-3-(trifluoromethyl)-2,4-dihydropyrrole |
| SMILES | FC(F)(F)[C@]1(c2ccccc2)CN=C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H14F3N/c18-17(19,20)16(14-9-5-2-6-10-14)11-15(21-12-16)13-7-3-1-4-8-13/h1-10H,11-12H2/t16-/m0/s1 |
| InChIKey | DDIFDUGQBJXYJE-INIZCTEOSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |