C35H32N2O2 — CID 134877237
(1E)-5-phenyl-1-[[2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methylidene]pyrazol-1-ium-3-olate (PubChem CID 134877237) has the molecular formula C35H32N2O2 and a molecular weight of 512.65 g/mol. Its IUPAC name is (1E)-5-phenyl-1-[[2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methylidene]pyrazol-1-ium-3-olate.
| Compound Name | (1E)-5-phenyl-1-[[2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methylidene]pyrazol-1-ium-3-olate |
|---|---|
| PubChem CID | 134877237 |
| Molecular Formula | C35H32N2O2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (1E)-5-phenyl-1-[[2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methylidene]pyrazol-1-ium-3-olate |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2/C(c2c(C)cc(C)cc2C)=[N+]2\N=C([O-])C=C2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C35H32N2O2/c1-21-16-23(3)32(24(4)17-21)34(37-30(20-31(38)36-37)27-12-8-7-9-13-27)28-14-10-11-15-29(28)35(39)33-25(5)18-22(2)19-26(33)6/h7-20H,1-6H3 |
| InChIKey | SXEFEVJOYHJCKS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|