C11H23NOSi — CID 134877298
3,3-dimethyl-1-trimethylsilylazepan-2-one (PubChem CID 134877298) has the molecular formula C11H23NOSi and a molecular weight of 213.40 g/mol. Its IUPAC name is 3,3-dimethyl-1-trimethylsilylazepan-2-one.
| Compound Name | 3,3-dimethyl-1-trimethylsilylazepan-2-one |
|---|---|
| PubChem CID | 134877298 |
| Molecular Formula | C11H23NOSi |
| Molecular Weight | 213.40 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3,3-dimethyl-1-trimethylsilylazepan-2-one |
| SMILES | CC1(C)CCCCN([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C11H23NOSi/c1-11(2)8-6-7-9-12(10(11)13)14(3,4)5/h6-9H2,1-5H3 |
| InChIKey | SPCPJNQKXVLEEL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|