C21H31NO3 — CID 134877376
ethyl (4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine-2-carboxylate (PubChem CID 134877376) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is ethyl (4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine-2-carboxylate.
| Compound Name | ethyl (4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine-2-carboxylate |
|---|---|
| PubChem CID | 134877376 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | ethyl (4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine-2-carboxylate |
| SMILES | CCOC(=O)C1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO3/c1-5-24-20(23)19-22(14-16-9-7-6-8-10-16)21(3,4)17-12-11-15(2)13-18(17)25-19/h6-10,15,17-19H,5,11-14H2,1-4H3/t15-,17-,18-,19?/m1/s1 |
| InChIKey | MHQZGEVNOFAWJU-WUDVTJOCSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |